C41H27N7 — CID 118582359
2-(3,5-dipyridin-2-ylphenyl)-4,6-bis(4-pyridin-2-ylphenyl)-1,3,5-triazine (PubChem CID 118582359) has the molecular formula C41H27N7 and a molecular weight of 617.72 g/mol. Its IUPAC name is 2-(3,5-dipyridin-2-ylphenyl)-4,6-bis(4-pyridin-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dipyridin-2-ylphenyl)-4,6-bis(4-pyridin-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118582359 |
| Molecular Formula | C41H27N7 |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | 2-(3,5-dipyridin-2-ylphenyl)-4,6-bis(4-pyridin-2-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccn5)cc4)nc(-c4cc(-c5ccccn5)cc(-c5ccccn5)c4)n3)cc2)nc1 |
| InChI | InChI=1S/C41H27N7/c1-5-21-42-35(9-1)28-13-17-30(18-14-28)39-46-40(31-19-15-29(16-20-31)36-10-2-6-22-43-36)48-41(47-39)34-26-32(37-11-3-7-23-44-37)25-33(27-34)38-12-4-8-24-45-38/h1-27H |
| InChIKey | OESWICVDDWNJBZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |