C48H52N10 — CID 176843193
2,4-ditert-butyl-6-[3-[4-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-1,3,5-triazine (PubChem CID 176843193) has the molecular formula C48H52N10 and a molecular weight of 769.01 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[4-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[3-[4-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176843193 |
| Molecular Formula | C48H52N10 |
| Molecular Weight | 769.01 g/mol |
| Exact Mass | 768.44 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[4-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccn5)cc(-c5nc(C(C)(C)C)nc(C(C)(C)C)n5)c4)n3)cc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C48H52N10/c1-45(2,3)41-53-38(54-42(57-41)46(4,5)6)31-23-21-30(22-24-31)37-50-36(29-18-14-13-15-19-29)51-39(52-37)33-26-32(35-20-16-17-25-49-35)27-34(28-33)40-55-43(47(7,8)9)58-44(56-40)48(10,11)12/h13-28H,1-12H3 |
| InChIKey | XAGPLINLNDWBQY-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.01 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |