C37H31N3 — CID 176647044
2-tert-butyl-4-(4-phenylphenyl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 176647044) has the molecular formula C37H31N3 and a molecular weight of 517.68 g/mol. Its IUPAC name is 2-tert-butyl-4-(4-phenylphenyl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-(4-phenylphenyl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176647044 |
| Molecular Formula | C37H31N3 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-tert-butyl-4-(4-phenylphenyl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3cccc(-c4ccccc4)c3)cc2)n1 |
| InChI | InChI=1S/C37H31N3/c1-37(2,3)36-39-34(30-21-17-28(18-22-30)26-11-6-4-7-12-26)38-35(40-36)31-23-19-29(20-24-31)33-16-10-15-32(25-33)27-13-8-5-9-14-27/h4-25H,1-3H3 |
| InChIKey | WOXJDBZZVHWXLW-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |