C47H41N9 — CID 176843132
2,4-ditert-butyl-6-[3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine (PubChem CID 176843132) has the molecular formula C47H41N9 and a molecular weight of 731.91 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176843132 |
| Molecular Formula | C47H41N9 |
| Molecular Weight | 731.91 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)n3)c2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C47H41N9/c1-46(2,3)44-54-43(55-45(56-44)47(4,5)6)36-24-16-23-35(29-36)42-52-39(32-21-14-9-15-22-32)51-41(53-42)34-27-25-33(26-28-34)40-49-37(30-17-10-7-11-18-30)48-38(50-40)31-19-12-8-13-20-31/h7-29H,1-6H3 |
| InChIKey | IVOLVHQNFLWVJM-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.91 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |