C45H44FN9 — CID 176842898
2,4-ditert-butyl-6-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-5-[4-(4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine (PubChem CID 176842898) has the molecular formula C45H44FN9 and a molecular weight of 729.91 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-5-[4-(4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-5-[4-(4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176842898 |
| Molecular Formula | C45H44FN9 |
| Molecular Weight | 729.91 g/mol |
| Exact Mass | 729.37 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-5-[4-(4-fluorophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccc(F)cc4)n3)cc(-c3nc(C(C)(C)C)nc(C(C)(C)C)n3)c2)n1 |
| InChI | InChI=1S/C45H44FN9/c1-43(2,3)40-51-36(28-18-14-11-15-19-28)50-38(52-40)31-24-30(25-32(26-31)39-53-41(44(4,5)6)55-42(54-39)45(7,8)9)37-48-34(27-16-12-10-13-17-27)47-35(49-37)29-20-22-33(46)23-21-29/h10-26H,1-9H3 |
| InChIKey | ZEHDSPNVMRMUQC-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.91 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |