C33H27N3 — CID 168803765
2-tert-butyl-4-phenyl-6-(7-phenylphenanthren-2-yl)-1,3,5-triazine (PubChem CID 168803765) has the molecular formula C33H27N3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-tert-butyl-4-phenyl-6-(7-phenylphenanthren-2-yl)-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-phenyl-6-(7-phenylphenanthren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168803765 |
| Molecular Formula | C33H27N3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-tert-butyl-4-phenyl-6-(7-phenylphenanthren-2-yl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2ccc3c(ccc4cc(-c5ccccc5)ccc43)c2)n1 |
| InChI | InChI=1S/C33H27N3/c1-33(2,3)32-35-30(23-12-8-5-9-13-23)34-31(36-32)27-17-19-29-26(21-27)15-14-25-20-24(16-18-28(25)29)22-10-6-4-7-11-22/h4-21H,1-3H3 |
| InChIKey | KXGFMZRPDWTKRH-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|