C53H39N9 — CID 176842995
2-tert-butyl-4-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 176842995) has the molecular formula C53H39N9 and a molecular weight of 801.96 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842995 |
| Molecular Formula | C53H39N9 |
| Molecular Weight | 801.96 g/mol |
| Exact Mass | 801.33 |
| IUPAC Name | 2-tert-butyl-4-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc5ccccc45)n3)c2)n1 |
| InChI | InChI=1S/C53H39N9/c1-53(2,3)52-61-47(37-25-14-7-15-26-37)58-49(62-52)40-29-18-28-39(32-40)48-55-46(36-23-12-6-13-24-36)59-51(60-48)43-33-41(31-38-27-16-17-30-42(38)43)50-56-44(34-19-8-4-9-20-34)54-45(57-50)35-21-10-5-11-22-35/h4-33H,1-3H3 |
| InChIKey | USZSTZVDYSABQP-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.96 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |