C29H25N3 — CID 177113268
2-tert-butyl-4-naphthalen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 177113268) has the molecular formula C29H25N3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-tert-butyl-4-naphthalen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-naphthalen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177113268 |
| Molecular Formula | C29H25N3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-tert-butyl-4-naphthalen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2cccc(-c3ccccc3)c2)nc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C29H25N3/c1-29(2,3)28-31-26(23-16-9-15-22(19-23)20-11-5-4-6-12-20)30-27(32-28)25-18-10-14-21-13-7-8-17-24(21)25/h4-19H,1-3H3 |
| InChIKey | WTHGOHUVLVHUEZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |