C31H25N3S — CID 177113429
2-tert-butyl-4-dibenzothiophen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 177113429) has the molecular formula C31H25N3S and a molecular weight of 471.63 g/mol. Its IUPAC name is 2-tert-butyl-4-dibenzothiophen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-dibenzothiophen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177113429 |
| Molecular Formula | C31H25N3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-tert-butyl-4-dibenzothiophen-1-yl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2cccc(-c3ccccc3)c2)nc(-c2cccc3sc4ccccc4c23)n1 |
| InChI | InChI=1S/C31H25N3S/c1-31(2,3)30-33-28(22-14-9-13-21(19-22)20-11-5-4-6-12-20)32-29(34-30)24-16-10-18-26-27(24)23-15-7-8-17-25(23)35-26/h4-19H,1-3H3 |
| InChIKey | PIOYWQFDNGPHNT-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |