C27H23N3 — CID 176627975
2-tert-butyl-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine (PubChem CID 176627975) has the molecular formula C27H23N3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-tert-butyl-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176627975 |
| Molecular Formula | C27H23N3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-tert-butyl-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2ccc3ccc4ccccc4c3c2)n1 |
| InChI | InChI=1S/C27H23N3/c1-27(2,3)26-29-24(20-10-5-4-6-11-20)28-25(30-26)21-16-15-19-14-13-18-9-7-8-12-22(18)23(19)17-21/h4-17H,1-3H3 |
| InChIKey | XDWFYZZEILKSSQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|