C47H40FN9 — CID 176842919
2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-fluorophenyl)-1,3,5-triazine (PubChem CID 176842919) has the molecular formula C47H40FN9 and a molecular weight of 749.90 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176842919 |
| Molecular Formula | C47H40FN9 |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.34 |
| IUPAC Name | 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-(4-fluorophenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5nc(-c6ccc(F)cc6)nc(C(C)(C)C)n5)c4)n3)c2)n1 |
| InChI | InChI=1S/C47H40FN9/c1-46(2,3)44-54-38(30-17-11-8-12-18-30)51-42(56-44)34-21-13-19-32(27-34)40-49-37(29-15-9-7-10-16-29)50-41(53-40)33-20-14-22-35(28-33)43-52-39(31-23-25-36(48)26-24-31)55-45(57-43)47(4,5)6/h7-28H,1-6H3 |
| InChIKey | LFSMENDQNFRXKS-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |