C52H44N10 — CID 176843202
2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-6-phenyl-1,3,5-triazine (PubChem CID 176843202) has the molecular formula C52H44N10 and a molecular weight of 808.99 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176843202 |
| Molecular Formula | C52H44N10 |
| Molecular Weight | 808.99 g/mol |
| Exact Mass | 808.38 |
| IUPAC Name | 2-tert-butyl-4-[3-[4-[3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-pyridin-2-ylphenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccn5)cc(-c5nc(-c6ccccc6)nc(C(C)(C)C)n5)c4)n3)c2)n1 |
| InChI | InChI=1S/C52H44N10/c1-51(2,3)49-59-43(34-21-12-8-13-22-34)56-46(61-49)37-26-18-25-36(29-37)45-54-42(33-19-10-7-11-20-33)55-47(58-45)39-30-38(41-27-16-17-28-53-41)31-40(32-39)48-57-44(35-23-14-9-15-24-35)60-50(62-48)52(4,5)6/h7-32H,1-6H3 |
| InChIKey | GXECLMSZHDERGB-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.99 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |