C30H25N9 — CID 176843031
2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-6-methyl-1,3,5-triazine (PubChem CID 176843031) has the molecular formula C30H25N9 and a molecular weight of 511.59 g/mol. Its IUPAC name is 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-6-methyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176843031 |
| Molecular Formula | C30H25N9 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)naphthalen-1-yl]-4-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2cccc(-c3nc(C)nc(-c4cc(-c5nc(C)nc(C)n5)cc5ccccc45)n3)c2)n1 |
| InChI | InChI=1S/C30H25N9/c1-16-31-17(2)34-27(33-16)22-10-8-11-23(14-22)28-37-20(5)38-30(39-28)26-15-24(13-21-9-6-7-12-25(21)26)29-35-18(3)32-19(4)36-29/h6-15H,1-5H3 |
| InChIKey | WDQANHOQWBDWIQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |