C36H27N9 — CID 176842997
2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176842997) has the molecular formula C36H27N9 and a molecular weight of 585.68 g/mol. Its IUPAC name is 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842997 |
| Molecular Formula | C36H27N9 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 2-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-5-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2cc(-c3nc(C)nc(-c4ccccc4)n3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C36H27N9/c1-22-37-23(2)39-34(38-22)28-19-29(35-41-24(3)40-31(42-35)25-13-7-4-8-14-25)21-30(20-28)36-44-32(26-15-9-5-10-16-26)43-33(45-36)27-17-11-6-12-18-27/h4-21H,1-3H3 |
| InChIKey | NKZZFRKTWLZFAG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |