C21H27I2N3 — CID 158896217
2,4-dimethyl-6-(4-phenylphenyl)-1,3,5-triazine;ethane;molecular iodine (PubChem CID 158896217) has the molecular formula C21H27I2N3 and a molecular weight of 575.28 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4-phenylphenyl)-1,3,5-triazine;ethane;molecular iodine.
| Compound Name | 2,4-dimethyl-6-(4-phenylphenyl)-1,3,5-triazine;ethane;molecular iodine |
|---|---|
| PubChem CID | 158896217 |
| Molecular Formula | C21H27I2N3 |
| Molecular Weight | 575.28 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | 2,4-dimethyl-6-(4-phenylphenyl)-1,3,5-triazine;ethane;molecular iodine |
| SMILES | CC.CC.Cc1nc(C)nc(-c2ccc(-c3ccccc3)cc2)n1.II |
| InChI | InChI=1S/C17H15N3.2C2H6.I2/c1-12-18-13(2)20-17(19-12)16-10-8-15(9-11-16)14-6-4-3-5-7-14;3*1-2/h3-11H,1-2H3;2*1-2H3; |
| InChIKey | JEWCEUKJZUUMCN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.28 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|