C36H28N10 — CID 176842864
2,4-dimethyl-6-[4-[4-methyl-6-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine (PubChem CID 176842864) has the molecular formula C36H28N10 and a molecular weight of 600.69 g/mol. Its IUPAC name is 2,4-dimethyl-6-[4-[4-methyl-6-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-dimethyl-6-[4-[4-methyl-6-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176842864 |
| Molecular Formula | C36H28N10 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 2,4-dimethyl-6-[4-[4-methyl-6-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)-5-pyridin-3-ylphenyl]-1,3,5-triazin-2-yl]phenyl]-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2ccc(-c3nc(C)nc(-c4cc(-c5cccnc5)cc(-c5nc(C)nc(-c6ccccc6)n5)c4)n3)cc2)n1 |
| InChI | InChI=1S/C36H28N10/c1-21-38-22(2)40-32(39-21)26-12-14-27(15-13-26)34-42-24(4)44-36(46-34)31-18-29(28-11-8-16-37-20-28)17-30(19-31)35-43-23(3)41-33(45-35)25-9-6-5-7-10-25/h5-20H,1-4H3 |
| InChIKey | YQYNLKRDJANKBC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |