C48H35N11 — CID 138579045
2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-3-ylphenyl]carbazole (PubChem CID 138579045) has the molecular formula C48H35N11 and a molecular weight of 765.89 g/mol. Its IUPAC name is 2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-3-ylphenyl]carbazole.
| Compound Name | 2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-3-ylphenyl]carbazole |
|---|---|
| PubChem CID | 138579045 |
| Molecular Formula | C48H35N11 |
| Molecular Weight | 765.89 g/mol |
| Exact Mass | 765.31 |
| IUPAC Name | 2,7-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-3-ylphenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccc(-c5nc(C)nc(C)n5)cc4n(-c4ccc(-c5cccnc5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)n1 |
| InChI | InChI=1S/C48H35N11/c1-28-50-29(2)53-46(52-28)35-17-20-38-39-21-18-36(47-54-30(3)51-31(4)55-47)26-43(39)59(42(38)25-35)41-22-19-34(37-16-11-23-49-27-37)24-40(41)48-57-44(32-12-7-5-8-13-32)56-45(58-48)33-14-9-6-10-15-33/h5-27H,1-4H3 |
| InChIKey | DHCHXRDNOVBLED-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.89 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |