C56H38N8 — CID 155232297
3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-3-yl)phenyl]carbazole (PubChem CID 155232297) has the molecular formula C56H38N8 and a molecular weight of 822.98 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-3-yl)phenyl]carbazole.
| Compound Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-3-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 155232297 |
| Molecular Formula | C56H38N8 |
| Molecular Weight | 822.98 g/mol |
| Exact Mass | 822.32 |
| IUPAC Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-3-yl)phenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C56H38N8/c1-35-57-36(2)59-55(58-35)41-28-31-51-46(34-41)44-23-13-15-25-49(44)64(51)52-30-27-40(39-26-29-50-45(32-39)43-22-12-14-24-48(43)63(50)42-20-10-5-11-21-42)33-47(52)56-61-53(37-16-6-3-7-17-37)60-54(62-56)38-18-8-4-9-19-38/h3-34H,1-2H3 |
| InChIKey | MJAYFLYUDOFPIJ-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.98 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |