C48H31N7 — CID 137421138
9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 137421138) has the molecular formula C48H31N7 and a molecular weight of 705.83 g/mol. Its IUPAC name is 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 137421138 |
| Molecular Formula | C48H31N7 |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C48H31N7/c1-5-17-32(18-6-1)43-49-44(33-19-7-2-8-20-33)52-47(51-43)36-29-30-42(55-40-27-15-13-25-37(40)38-26-14-16-28-41(38)55)39(31-36)48-53-45(34-21-9-3-10-22-34)50-46(54-48)35-23-11-4-12-24-35/h1-31H |
| InChIKey | MZHTZALJKORTHO-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |