C78H49N13 — CID 137414597
9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 137414597) has the molecular formula C78H49N13 and a molecular weight of 1168.34 g/mol. Its IUPAC name is 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 137414597 |
| Molecular Formula | C78H49N13 |
| Molecular Weight | 1168.34 g/mol |
| Exact Mass | 1167.42 |
| IUPAC Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-n4c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5c5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C78H49N13/c1-9-25-50(26-10-1)67-79-68(51-27-11-2-12-28-51)84-75(83-67)58-41-44-64-61(47-58)62-48-59(76-85-69(52-29-13-3-14-30-52)80-70(86-76)53-31-15-4-16-32-53)42-45-65(62)91(64)66-46-43-60(77-87-71(54-33-17-5-18-34-54)81-72(88-77)55-35-19-6-20-36-55)49-63(66)78-89-73(56-37-21-7-22-38-56)82-74(90-78)57-39-23-8-24-40-57/h1-49H |
| InChIKey | QCMHPKNSEILWAS-UHFFFAOYSA-N |
| XLogP | 17.53 |
| TPSA | 159.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1168.34 |
| LogP ≤ 5 | 17.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |