C54H33F2N7 — CID 138565238
9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 138565238) has the molecular formula C54H33F2N7 and a molecular weight of 817.90 g/mol. Its IUPAC name is 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 138565238 |
| Molecular Formula | C54H33F2N7 |
| Molecular Weight | 817.90 g/mol |
| Exact Mass | 817.28 |
| IUPAC Name | 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Fc1cc(F)cc(-c2ccc(-n3c4ccccc4c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc43)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C54H33F2N7/c55-41-29-40(30-42(56)33-41)38-25-27-48(45(31-38)54-61-51(36-19-9-3-10-20-36)58-52(62-54)37-21-11-4-12-22-37)63-46-24-14-13-23-43(46)44-32-39(26-28-47(44)63)53-59-49(34-15-5-1-6-16-34)57-50(60-53)35-17-7-2-8-18-35/h1-33H |
| InChIKey | MNHBAKQPCXOGKT-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.90 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |