C51H31F2N5 — CID 138565341
3-carbazol-9-yl-9-[5-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 138565341) has the molecular formula C51H31F2N5 and a molecular weight of 751.84 g/mol. Its IUPAC name is 3-carbazol-9-yl-9-[5-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 3-carbazol-9-yl-9-[5-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 138565341 |
| Molecular Formula | C51H31F2N5 |
| Molecular Weight | 751.84 g/mol |
| Exact Mass | 751.25 |
| IUPAC Name | 3-carbazol-9-yl-9-[5-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | Fc1cc(F)cc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-n3c4ccccc4c4cc(-n5c6ccccc6c6ccccc65)ccc43)c2)c1 |
| InChI | InChI=1S/C51H31F2N5/c52-36-27-35(28-37(53)30-36)34-23-25-42(51-55-49(32-13-3-1-4-14-32)54-50(56-51)33-15-5-2-6-16-33)48(29-34)58-46-22-12-9-19-41(46)43-31-38(24-26-47(43)58)57-44-20-10-7-17-39(44)40-18-8-11-21-45(40)57/h1-31H |
| InChIKey | OTCOYLJAFBGRLG-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.84 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |