C48H34F2N4 — CID 146414962
9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4,6-trimethylphenyl)carbazole (PubChem CID 146414962) has the molecular formula C48H34F2N4 and a molecular weight of 704.82 g/mol. Its IUPAC name is 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 146414962 |
| Molecular Formula | C48H34F2N4 |
| Molecular Weight | 704.82 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | 9-[4-(3,5-difluorophenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3cc(F)cc(F)c3)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C48H34F2N4/c1-29-22-30(2)45(31(3)23-29)35-19-21-43-40(27-35)39-16-10-11-17-42(39)54(43)44-20-18-34(36-24-37(49)28-38(50)25-36)26-41(44)48-52-46(32-12-6-4-7-13-32)51-47(53-48)33-14-8-5-9-15-33/h4-28H,1-3H3 |
| InChIKey | LUVHXQKKZVOBON-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.82 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |