C65H47N7 — CID 138712816
3-[4-[5-cyano-2-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 138712816) has the molecular formula C65H47N7 and a molecular weight of 926.14 g/mol. Its IUPAC name is 3-[4-[5-cyano-2-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 3-[4-[5-cyano-2-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 138712816 |
| Molecular Formula | C65H47N7 |
| Molecular Weight | 926.14 g/mol |
| Exact Mass | 925.39 |
| IUPAC Name | 3-[4-[5-cyano-2-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2ccc(C#N)cc2-c2nc(-c3ccccc3)nc(-c3cc(C#N)ccc3-n3c4ccccc4c4cc(-c5c(C)cc(C)cc5C)ccc43)n2)c(C)c1 |
| InChI | InChI=1S/C65H47N7/c1-38-28-40(3)61(41(4)29-38)47-22-26-57-51(34-47)49-16-10-12-18-55(49)71(57)59-24-20-44(36-66)32-53(59)64-68-63(46-14-8-7-9-15-46)69-65(70-64)54-33-45(37-67)21-25-60(54)72-56-19-13-11-17-50(56)52-35-48(23-27-58(52)72)62-42(5)30-39(2)31-43(62)6/h7-35H,1-6H3 |
| InChIKey | PRCGXQIBKQPDAC-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 96.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.14 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |