C64H48N6 — CID 138729208
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 138729208) has the molecular formula C64H48N6 and a molecular weight of 901.13 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 138729208 |
| Molecular Formula | C64H48N6 |
| Molecular Weight | 901.13 g/mol |
| Exact Mass | 900.39 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,5-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2cc(C#N)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-n2c3ccccc3c3cc(-c4c(C)cc(C)cc4C)ccc32)c(C)c1 |
| InChI | InChI=1S/C64H48N6/c1-38-29-40(3)60(41(4)30-38)46-25-27-56-52(33-46)49-21-13-15-23-54(49)69(56)58-35-48(37-65)51(64-67-62(44-17-9-7-10-18-44)66-63(68-64)45-19-11-8-12-20-45)36-59(58)70-55-24-16-14-22-50(55)53-34-47(26-28-57(53)70)61-42(5)31-39(2)32-43(61)6/h7-36H,1-6H3 |
| InChIKey | ZNJHLQKGPPHLKW-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.13 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |