C62H44N6 — CID 138729264
2,5-bis[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 138729264) has the molecular formula C62H44N6 and a molecular weight of 873.08 g/mol. Its IUPAC name is 2,5-bis[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 2,5-bis[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 138729264 |
| Molecular Formula | C62H44N6 |
| Molecular Weight | 873.08 g/mol |
| Exact Mass | 872.36 |
| IUPAC Name | 2,5-bis[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-n3c4ccccc4c4cc(-c5ccc(C)cc5C)ccc43)cc2C#N)c(C)c1 |
| InChI | InChI=1S/C62H44N6/c1-38-23-27-47(40(3)31-38)44-25-29-56-51(33-44)49-19-11-13-21-54(49)67(56)58-36-53(62-65-60(42-15-7-5-8-16-42)64-61(66-62)43-17-9-6-10-18-43)59(35-46(58)37-63)68-55-22-14-12-20-50(55)52-34-45(26-30-57(52)68)48-28-24-39(2)32-41(48)4/h5-36H,1-4H3 |
| InChIKey | HDRVDBLNCSYFPE-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.08 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |