C56H39N7 — CID 167168633
9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4-dimethylphenyl)carbazole (PubChem CID 167168633) has the molecular formula C56H39N7 and a molecular weight of 809.98 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4-dimethylphenyl)carbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 167168633 |
| Molecular Formula | C56H39N7 |
| Molecular Weight | 809.98 g/mol |
| Exact Mass | 809.33 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(2,4-dimethylphenyl)carbazole |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C56H39N7/c1-36-30-32-43(37(2)34-36)42-31-33-49-47(35-42)44-26-15-16-29-48(44)63(49)50-45(55-59-51(38-18-7-3-8-19-38)57-52(60-55)39-20-9-4-10-21-39)27-17-28-46(50)56-61-53(40-22-11-5-12-23-40)58-54(62-56)41-24-13-6-14-25-41/h3-35H,1-2H3 |
| InChIKey | PIPJWIIIDFPDGO-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.98 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |