C53H36N10 — CID 167168647
9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 167168647) has the molecular formula C53H36N10 and a molecular weight of 812.94 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 167168647 |
| Molecular Formula | C53H36N10 |
| Molecular Weight | 812.94 g/mol |
| Exact Mass | 812.31 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C53H36N10/c1-33-54-34(2)56-51(55-33)39-30-31-45-43(32-39)40-26-15-16-29-44(40)63(45)46-41(52-59-47(35-18-7-3-8-19-35)57-48(60-52)36-20-9-4-10-21-36)27-17-28-42(46)53-61-49(37-22-11-5-12-23-37)58-50(62-53)38-24-13-6-14-25-38/h3-32H,1-2H3 |
| InChIKey | DWZYEHSYBOIJBK-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.94 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |