C34H27N7 — CID 137414472
9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazole (PubChem CID 137414472) has the molecular formula C34H27N7 and a molecular weight of 533.64 g/mol. Its IUPAC name is 9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazole.
| Compound Name | 9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazole |
|---|---|
| PubChem CID | 137414472 |
| Molecular Formula | C34H27N7 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 9-[2,4-bis(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3-phenylcarbazole |
| SMILES | Cc1nc(C)nc(-c2ccc(-n3c4ccccc4c4cc(-c5ccccc5)ccc43)c(-c3nc(C)nc(C)n3)c2)n1 |
| InChI | InChI=1S/C34H27N7/c1-20-35-21(2)38-33(37-20)26-15-17-32(29(19-26)34-39-22(3)36-23(4)40-34)41-30-13-9-8-12-27(30)28-18-25(14-16-31(28)41)24-10-6-5-7-11-24/h5-19H,1-4H3 |
| InChIKey | KNMCZXFYZNBNPM-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |