C55H34N8 — CID 137421119
4-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile (PubChem CID 137421119) has the molecular formula C55H34N8 and a molecular weight of 806.93 g/mol. Its IUPAC name is 4-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile.
| Compound Name | 4-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 137421119 |
| Molecular Formula | C55H34N8 |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 806.29 |
| IUPAC Name | 4-[9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C55H34N8/c56-35-36-25-27-37(28-26-36)42-29-31-48-45(33-42)44-23-13-14-24-47(44)63(48)49-32-30-43(54-59-50(38-15-5-1-6-16-38)57-51(60-54)39-17-7-2-8-18-39)34-46(49)55-61-52(40-19-9-3-10-20-40)58-53(62-55)41-21-11-4-12-22-41/h1-34H |
| InChIKey | SLQDMYJFLQKHNT-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 106.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |