C82H52N6 — CID 139496057
4-[4-(3,6-diphenylcarbazol-9-yl)-3-[4-(3,6-diphenylcarbazol-9-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile (PubChem CID 139496057) has the molecular formula C82H52N6 and a molecular weight of 1121.36 g/mol. Its IUPAC name is 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[4-(3,6-diphenylcarbazol-9-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[4-(3,6-diphenylcarbazol-9-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139496057 |
| Molecular Formula | C82H52N6 |
| Molecular Weight | 1121.36 g/mol |
| Exact Mass | 1120.43 |
| IUPAC Name | 4-[4-(3,6-diphenylcarbazol-9-yl)-3-[4-(3,6-diphenylcarbazol-9-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)c(-c3ccc(-n4c5ccc(-c6ccccc6)cc5c5cc(-c6ccccc6)ccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C82H52N6/c83-53-54-31-33-59(34-32-54)62-35-41-74(87-75-42-36-63(55-19-7-1-8-20-55)48-69(75)70-49-64(37-43-76(70)87)56-21-9-2-10-22-56)68(47-62)67-40-46-79(73(52-67)82-85-80(60-27-15-5-16-28-60)84-81(86-82)61-29-17-6-18-30-61)88-77-44-38-65(57-23-11-3-12-24-57)50-71(77)72-51-66(39-45-78(72)88)58-25-13-4-14-26-58/h1-52H |
| InChIKey | MRFSOXKGVDWNHT-UHFFFAOYSA-N |
| XLogP | 20.94 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.36 |
| LogP ≤ 5 | 20.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |