C70H42N12 — CID 170445850
4-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 170445850) has the molecular formula C70H42N12 and a molecular weight of 1051.19 g/mol. Its IUPAC name is 4-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 4-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 170445850 |
| Molecular Formula | C70H42N12 |
| Molecular Weight | 1051.19 g/mol |
| Exact Mass | 1050.37 |
| IUPAC Name | 4-[3,6-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]-3-(4-carbazol-9-yl-6-phenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc32)c(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccccc43)n2)c1 |
| InChI | InChI=1S/C70H42N12/c71-43-44-34-37-61(56(40-44)69-78-66(49-28-14-5-15-29-49)79-70(80-69)82-57-32-18-16-30-52(57)53-31-17-19-33-58(53)82)81-59-38-35-50(67-74-62(45-20-6-1-7-21-45)72-63(75-67)46-22-8-2-9-23-46)41-54(59)55-42-51(36-39-60(55)81)68-76-64(47-24-10-3-11-25-47)73-65(77-68)48-26-12-4-13-27-48/h1-42H |
| InChIKey | NDHXRGDZWDJDBK-UHFFFAOYSA-N |
| XLogP | 15.64 |
| TPSA | 149.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.19 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |