C65H62N8 — CID 146429626
3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile (PubChem CID 146429626) has the molecular formula C65H62N8 and a molecular weight of 955.27 g/mol. Its IUPAC name is 3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile.
| Compound Name | 3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 146429626 |
| Molecular Formula | C65H62N8 |
| Molecular Weight | 955.27 g/mol |
| Exact Mass | 954.51 |
| IUPAC Name | 3-[4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazin-2-yl]-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-9-yl]benzonitrile |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3cc(C#N)ccc3-n3c4ccccc4c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc43)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C65H62N8/c1-62(2,3)46-32-44(33-47(37-46)63(4,5)6)59-70-60(45-34-48(64(7,8)9)38-49(35-45)65(10,11)12)72-61(71-59)52-31-40(39-66)27-29-55(52)73-53-26-20-19-25-50(53)51-36-43(28-30-54(51)73)58-68-56(41-21-15-13-16-22-41)67-57(69-58)42-23-17-14-18-24-42/h13-38H,1-12H3 |
| InChIKey | FVLFECNQISNVNA-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 106.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.27 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |