C44H33N5 — CID 177108817
3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-4-(3,6-diphenylcarbazol-9-yl)benzonitrile (PubChem CID 177108817) has the molecular formula C44H33N5 and a molecular weight of 631.78 g/mol. Its IUPAC name is 3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-4-(3,6-diphenylcarbazol-9-yl)benzonitrile.
| Compound Name | 3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-4-(3,6-diphenylcarbazol-9-yl)benzonitrile |
|---|---|
| PubChem CID | 177108817 |
| Molecular Formula | C44H33N5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 3-(4-tert-butyl-6-phenyl-1,3,5-triazin-2-yl)-4-(3,6-diphenylcarbazol-9-yl)benzonitrile |
| SMILES | CC(C)(C)c1nc(-c2ccccc2)nc(-c2cc(C#N)ccc2-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)n1 |
| InChI | InChI=1S/C44H33N5/c1-44(2,3)43-47-41(32-17-11-6-12-18-32)46-42(48-43)37-25-29(28-45)19-22-40(37)49-38-23-20-33(30-13-7-4-8-14-30)26-35(38)36-27-34(21-24-39(36)49)31-15-9-5-10-16-31/h4-27H,1-3H3 |
| InChIKey | SELQZONWJUGAEK-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |