C50H37N5 — CID 134508097
4-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134508097) has the molecular formula C50H37N5 and a molecular weight of 707.88 g/mol. Its IUPAC name is 4-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 4-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134508097 |
| Molecular Formula | C50H37N5 |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | 4-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-3-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2ccc(C#N)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C50H37N5/c1-31-21-32(2)24-40(23-31)38-16-19-45-42(28-38)43-29-39(41-25-33(3)22-34(4)26-41)17-20-46(43)55(45)47-18-15-35(30-51)27-44(47)50-53-48(36-11-7-5-8-12-36)52-49(54-50)37-13-9-6-10-14-37/h5-29H,1-4H3 |
| InChIKey | DSZNEFVYRDWTMX-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |