C54H42N8 — CID 163536109
9-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]phenyl]phenyl]-3-methylcarbazole (PubChem CID 163536109) has the molecular formula C54H42N8 and a molecular weight of 802.99 g/mol. Its IUPAC name is 9-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]phenyl]phenyl]-3-methylcarbazole.
| Compound Name | 9-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]phenyl]phenyl]-3-methylcarbazole |
|---|---|
| PubChem CID | 163536109 |
| Molecular Formula | C54H42N8 |
| Molecular Weight | 802.99 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | 9-[2-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)-4-(3-methylcarbazol-9-yl)phenyl]phenyl]phenyl]-3-methylcarbazole |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2cccc(-c3ccc(-n4c5ccccc5c5cc(C)ccc54)c(-c4nc(C)nc(C)n4)c3)c2)cc1-c1nc(C)nc(C)n1 |
| InChI | InChI=1S/C54H42N8/c1-31-18-22-49-43(26-31)41-14-7-9-16-47(41)61(49)51-24-20-39(29-45(51)53-57-33(3)55-34(4)58-53)37-12-11-13-38(28-37)40-21-25-52(46(30-40)54-59-35(5)56-36(6)60-54)62-48-17-10-8-15-42(48)44-27-32(2)19-23-50(44)62/h7-30H,1-6H3 |
| InChIKey | CKWYWMRLOMIGMJ-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.99 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |