C56H46N8 — CID 163501090
9-[2-[3-[2-(3,6-dimethylcarbazol-9-yl)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole (PubChem CID 163501090) has the molecular formula C56H46N8 and a molecular weight of 831.04 g/mol. Its IUPAC name is 9-[2-[3-[2-(3,6-dimethylcarbazol-9-yl)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[2-[3-[2-(3,6-dimethylcarbazol-9-yl)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 163501090 |
| Molecular Formula | C56H46N8 |
| Molecular Weight | 831.04 g/mol |
| Exact Mass | 830.38 |
| IUPAC Name | 9-[2-[3-[2-(3,6-dimethylcarbazol-9-yl)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2nc(C)nc(C)n2)cc1-c1cccc(-c2ccc(-c3nc(C)nc(C)n3)cc2-n2c3ccc(C)cc3c3cc(C)ccc32)c1 |
| InChI | InChI=1S/C56H46N8/c1-31-12-19-50-45(24-31)46-25-32(2)13-20-51(46)63(50)49-23-17-41(55-59-35(5)57-36(6)60-55)29-44(49)40-11-9-10-39(28-40)43-18-16-42(56-61-37(7)58-38(8)62-56)30-54(43)64-52-21-14-33(3)26-47(52)48-27-34(4)15-22-53(48)64/h9-30H,1-8H3 |
| InChIKey | ZSMGZBFYUQXEFY-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.04 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |