C50H33N7S — CID 155232271
9-[4-dibenzothiophen-2-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 155232271) has the molecular formula C50H33N7S and a molecular weight of 763.93 g/mol. Its IUPAC name is 9-[4-dibenzothiophen-2-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-dibenzothiophen-2-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 155232271 |
| Molecular Formula | C50H33N7S |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 763.25 |
| IUPAC Name | 9-[4-dibenzothiophen-2-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c4ccccc4n(-c4ccc(-c5ccc6sc7ccccc7c6c5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)n1 |
| InChI | InChI=1S/C50H33N7S/c1-30-51-31(2)53-49(52-30)36-21-24-38-37-17-9-11-19-42(37)57(44(38)29-36)43-25-22-34(35-23-26-46-40(27-35)39-18-10-12-20-45(39)58-46)28-41(43)50-55-47(32-13-5-3-6-14-32)54-48(56-50)33-15-7-4-8-16-33/h3-29H,1-2H3 |
| InChIKey | HVNVBCHPHBMCCK-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |