C60H35N7OS — CID 147613320
11-[4-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1]benzofuro[3,2-b]carbazole (PubChem CID 147613320) has the molecular formula C60H35N7OS and a molecular weight of 902.06 g/mol. Its IUPAC name is 11-[4-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1]benzofuro[3,2-b]carbazole.
| Compound Name | 11-[4-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1]benzofuro[3,2-b]carbazole |
|---|---|
| PubChem CID | 147613320 |
| Molecular Formula | C60H35N7OS |
| Molecular Weight | 902.06 g/mol |
| Exact Mass | 901.26 |
| IUPAC Name | 11-[4-(4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-[1]benzofuro[3,2-b]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-n4c5ccccc5c5cc6oc7ccccc7c6cc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)nc(-c3ccc4sc5ccccc5c4c3)n2)cc1 |
| InChI | InChI=1S/C60H35N7OS/c1-4-16-36(17-5-1)55-62-58(64-59(63-55)40-29-31-54-46(32-40)43-24-12-15-27-53(43)69-54)39-28-30-49(47(33-39)60-65-56(37-18-6-2-7-19-37)61-57(66-60)38-20-8-3-9-21-38)67-48-25-13-10-22-41(48)44-35-52-45(34-50(44)67)42-23-11-14-26-51(42)68-52/h1-35H |
| InChIKey | GCKPSOVIGYHHEC-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.06 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |