C62H41N5 — CID 137414540
9-[2,4-bis(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-diphenylcarbazole (PubChem CID 137414540) has the molecular formula C62H41N5 and a molecular weight of 856.05 g/mol. Its IUPAC name is 9-[2,4-bis(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2,4-bis(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 137414540 |
| Molecular Formula | C62H41N5 |
| Molecular Weight | 856.05 g/mol |
| Exact Mass | 855.34 |
| IUPAC Name | 9-[2,4-bis(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C62H41N5/c1-7-19-42(20-8-1)48-31-34-58-51(37-48)52-38-49(43-21-9-2-10-22-43)32-35-59(52)67(58)60-36-33-50(61-63-54(44-23-11-3-12-24-44)40-55(64-61)45-25-13-4-14-26-45)39-53(60)62-65-56(46-27-15-5-16-28-46)41-57(66-62)47-29-17-6-18-30-47/h1-41H |
| InChIKey | JTMGLWCWDXQFEX-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.05 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |