C60H43N11 — CID 137414796
3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole (PubChem CID 137414796) has the molecular formula C60H43N11 and a molecular weight of 918.08 g/mol. Its IUPAC name is 3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole.
| Compound Name | 3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 137414796 |
| Molecular Formula | C60H43N11 |
| Molecular Weight | 918.08 g/mol |
| Exact Mass | 917.37 |
| IUPAC Name | 3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenylpyrimidin-2-yl)phenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2ccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C60H43N11/c1-36-61-37(2)64-58(63-36)44-25-28-54-47(31-44)48-32-45(59-65-38(3)62-39(4)66-59)26-29-55(48)71(54)56-30-27-46(60-68-50(40-17-9-5-10-18-40)34-51(69-60)41-19-11-6-12-20-41)33-49(56)53-35-52(42-21-13-7-14-22-42)67-57(70-53)43-23-15-8-16-24-43/h5-35H,1-4H3 |
| InChIKey | IQJLCDUJEZXQCS-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.08 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |