C65H48N6 — CID 137420940
3,6-bis(3,5-dimethylphenyl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 137420940) has the molecular formula C65H48N6 and a molecular weight of 913.14 g/mol. Its IUPAC name is 3,6-bis(3,5-dimethylphenyl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 3,6-bis(3,5-dimethylphenyl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 137420940 |
| Molecular Formula | C65H48N6 |
| Molecular Weight | 913.14 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | 3,6-bis(3,5-dimethylphenyl)-9-[2-(2,6-diphenylpyrimidin-4-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C65H48N6/c1-41-31-42(2)34-52(33-41)49-25-28-59-54(37-49)55-38-50(53-35-43(3)32-44(4)36-53)26-29-60(55)71(59)61-30-27-51(65-69-63(47-21-13-7-14-22-47)68-64(70-65)48-23-15-8-16-24-48)39-56(61)58-40-57(45-17-9-5-10-18-45)66-62(67-58)46-19-11-6-12-20-46/h5-40H,1-4H3 |
| InChIKey | XUFVVMMGMHPFIU-UHFFFAOYSA-N |
| XLogP | 16.33 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.14 |
| LogP ≤ 5 | 16.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |