C64H45N5 — CID 137420844
9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(3-methylphenyl)carbazole (PubChem CID 137420844) has the molecular formula C64H45N5 and a molecular weight of 884.10 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(3-methylphenyl)carbazole.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(3-methylphenyl)carbazole |
|---|---|
| PubChem CID | 137420844 |
| Molecular Formula | C64H45N5 |
| Molecular Weight | 884.10 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-3,6-bis(3-methylphenyl)carbazole |
| SMILES | Cc1cccc(-c2ccc3c(c2)c2cc(-c4cccc(C)c4)ccc2n3-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C64H45N5/c1-42-17-15-27-48(35-42)50-29-32-60-53(37-50)54-38-51(49-28-16-18-43(2)36-49)30-33-61(54)69(60)62-34-31-52(59-41-56(44-19-7-3-8-20-44)65-63(66-59)47-25-13-6-14-26-47)39-55(62)64-67-57(45-21-9-4-10-22-45)40-58(68-64)46-23-11-5-12-24-46/h3-41H,1-2H3 |
| InChIKey | BKIISSGAUGOVRK-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.10 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |