C66H43F6N5 — CID 160720659
9-[2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazole (PubChem CID 160720659) has the molecular formula C66H43F6N5 and a molecular weight of 1020.09 g/mol. Its IUPAC name is 9-[2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 9-[2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 160720659 |
| Molecular Formula | C66H43F6N5 |
| Molecular Weight | 1020.09 g/mol |
| Exact Mass | 1019.34 |
| IUPAC Name | 9-[2,4-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6-bis[3-methyl-5-(trifluoromethyl)phenyl]carbazole |
| SMILES | Cc1cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C(F)(F)F)c4)ccc2n3-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C66H43F6N5/c1-40-29-49(33-51(31-40)65(67,68)69)46-23-26-60-53(35-46)54-36-47(50-30-41(2)32-52(34-50)66(70,71)72)24-27-61(54)77(60)62-28-25-48(58-38-56(42-15-7-3-8-16-42)73-63(75-58)44-19-11-5-12-20-44)37-55(62)59-39-57(43-17-9-4-10-18-43)74-64(76-59)45-21-13-6-14-22-45/h3-39H,1-2H3 |
| InChIKey | JGFREVCOIJZKEO-UHFFFAOYSA-N |
| XLogP | 18.35 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.09 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |