C61H40N6 — CID 137414844
9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-diphenylcarbazole (PubChem CID 137414844) has the molecular formula C61H40N6 and a molecular weight of 857.03 g/mol. Its IUPAC name is 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-diphenylcarbazole.
| Compound Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-diphenylcarbazole |
|---|---|
| PubChem CID | 137414844 |
| Molecular Formula | C61H40N6 |
| Molecular Weight | 857.03 g/mol |
| Exact Mass | 856.33 |
| IUPAC Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c4ccc(-c5ccccc5)cc4n(-c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)cc1 |
| InChI | InChI=1S/C61H40N6/c1-7-19-41(20-8-1)47-31-34-50-51-35-32-48(42-21-9-2-10-22-42)39-57(51)67(56(50)38-47)55-36-33-49(60-62-53(43-23-11-3-12-24-43)40-54(63-60)44-25-13-4-14-26-44)37-52(55)61-65-58(45-27-15-5-16-28-45)64-59(66-61)46-29-17-6-18-30-46/h1-40H |
| InChIKey | FRWRMCZIPQMNBQ-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.03 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |