C79H50N12 — CID 137414830
9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 137414830) has the molecular formula C79H50N12 and a molecular weight of 1167.35 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 137414830 |
| Molecular Formula | C79H50N12 |
| Molecular Weight | 1167.35 g/mol |
| Exact Mass | 1166.43 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,7-bis(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-n4c5cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc5c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C79H50N12/c1-9-25-51(26-10-1)65-50-66(81-70(80-65)52-27-11-2-12-28-52)59-43-46-67(64(47-59)79-89-75(57-37-21-7-22-38-57)84-76(90-79)58-39-23-8-24-40-58)91-68-48-60(77-85-71(53-29-13-3-14-30-53)82-72(86-77)54-31-15-4-16-32-54)41-44-62(68)63-45-42-61(49-69(63)91)78-87-73(55-33-17-5-18-34-55)83-74(88-78)56-35-19-6-20-36-56/h1-50H |
| InChIKey | RQOJBDNXPRBQDH-UHFFFAOYSA-N |
| XLogP | 18.13 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.35 |
| LogP ≤ 5 | 18.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |