C68H53N5 — CID 137420813
9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole (PubChem CID 137420813) has the molecular formula C68H53N5 and a molecular weight of 940.21 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 137420813 |
| Molecular Formula | C68H53N5 |
| Molecular Weight | 940.21 g/mol |
| Exact Mass | 939.43 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-2-(4,6-diphenylpyrimidin-2-yl)phenyl]-2,7-bis(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccc(-c5c(C)cc(C)cc5C)cc4n(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)cc4-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3c2)c(C)c1 |
| InChI | InChI=1S/C68H53N5/c1-42-33-44(3)65(45(4)34-42)53-27-30-55-56-31-28-54(66-46(5)35-43(2)36-47(66)6)39-64(56)73(63(55)38-53)62-32-29-52(61-41-58(48-19-11-7-12-20-48)69-67(70-61)51-25-17-10-18-26-51)37-57(62)68-71-59(49-21-13-8-14-22-49)40-60(72-68)50-23-15-9-16-24-50/h7-41H,1-6H3 |
| InChIKey | XRLLZVIZJFNUMS-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.21 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |