C58H42N6 — CID 137421098
9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole (PubChem CID 137421098) has the molecular formula C58H42N6 and a molecular weight of 823.02 g/mol. Its IUPAC name is 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 137421098 |
| Molecular Formula | C58H42N6 |
| Molecular Weight | 823.02 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 9-[4-(4,6-diphenylpyrimidin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c4ccccc4n(-c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c(C)c1 |
| InChI | InChI=1S/C58H42N6/c1-37-32-38(2)54(39(3)33-37)44-28-30-47-46-26-16-17-27-51(46)64(53(47)35-44)52-31-29-45(57-59-49(40-18-8-4-9-19-40)36-50(60-57)41-20-10-5-11-21-41)34-48(52)58-62-55(42-22-12-6-13-23-42)61-56(63-58)43-24-14-7-15-25-43/h4-36H,1-3H3 |
| InChIKey | XZKRWBCPXSIROS-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.02 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |