C79H54N12 — CID 162115065
9-[2,6-bis(2-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 162115065) has the molecular formula C79H54N12 and a molecular weight of 1171.38 g/mol. Its IUPAC name is 9-[2,6-bis(2-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[2,6-bis(2-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 162115065 |
| Molecular Formula | C79H54N12 |
| Molecular Weight | 1171.38 g/mol |
| Exact Mass | 1170.46 |
| IUPAC Name | 9-[2,6-bis(2-carbazol-9-ylphenyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2c(-c3ccccc3-n3c4ccccc4c4ccccc43)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccccc2-n2c3ccccc3c3ccccc32)n1 |
| InChI | InChI=1S/C79H54N12/c1-47-80-48(2)83-77(82-47)53-39-41-72-62(43-53)63-44-54(78-84-49(3)81-50(4)85-78)40-42-73(63)91(72)74-64(60-31-15-21-37-70(60)89-66-33-17-11-27-56(66)57-28-12-18-34-67(57)89)45-55(79-87-75(51-23-7-5-8-24-51)86-76(88-79)52-25-9-6-10-26-52)46-65(74)61-32-16-22-38-71(61)90-68-35-19-13-29-58(68)59-30-14-20-36-69(59)90/h5-46H,1-4H3 |
| InChIKey | DUXNMIGETUOTAP-UHFFFAOYSA-N |
| XLogP | 18.44 |
| TPSA | 130.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.38 |
| LogP ≤ 5 | 18.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |