C59H40F3N5 — CID 138555657
9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)carbazole (PubChem CID 138555657) has the molecular formula C59H40F3N5 and a molecular weight of 876.00 g/mol. Its IUPAC name is 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)carbazole.
| Compound Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 138555657 |
| Molecular Formula | C59H40F3N5 |
| Molecular Weight | 876.00 g/mol |
| Exact Mass | 875.32 |
| IUPAC Name | 9-[2,6-bis(4,6-diphenylpyrimidin-2-yl)-4-(trifluoromethyl)phenyl]-3-(2,4-dimethylphenyl)carbazole |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)cc(C(F)(F)F)cc2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C59H40F3N5/c1-37-27-29-45(38(2)31-37)43-28-30-55-47(32-43)46-25-15-16-26-54(46)67(55)56-48(57-63-50(39-17-7-3-8-18-39)35-51(64-57)40-19-9-4-10-20-40)33-44(59(60,61)62)34-49(56)58-65-52(41-21-11-5-12-22-41)36-53(66-58)42-23-13-6-14-24-42/h3-36H,1-2H3 |
| InChIKey | VMWVSCCCUDDDSV-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.00 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |